CAS 898752-94-8
:ethyl 8-oxo-8-(9-phenanthryl)octanoate
Description:
Ethyl 8-oxo-8-(9-phenanthryl)octanoate is an organic compound characterized by its ester functional group, which is derived from octanoic acid and ethyl alcohol. The presence of the 8-oxo group indicates that it contains a ketone functionality, contributing to its reactivity and potential applications in organic synthesis. The phenanthryl group, a polycyclic aromatic hydrocarbon, imparts unique electronic and steric properties, making the compound of interest in various chemical and pharmaceutical research contexts. This compound is likely to exhibit moderate solubility in organic solvents due to its hydrophobic nature, while its molecular structure suggests potential for interactions such as π-π stacking due to the aromatic system. Additionally, the compound may possess interesting biological activities, which could be explored in drug development or as a building block in the synthesis of more complex molecules. Safety and handling precautions should be observed, as with any chemical substance, particularly those with potential biological activity.
Formula:C24H26O3
InChI:InChI=1/C24H26O3/c1-2-27-24(26)16-6-4-3-5-15-23(25)22-17-18-11-7-8-12-19(18)20-13-9-10-14-21(20)22/h7-14,17H,2-6,15-16H2,1H3
SMILES:CCOC(=O)CCCCCCC(=O)c1cc2ccccc2c2ccccc12
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.