CAS 898752-98-2
:ethyl 5-(2,3-difluorophenyl)-5-oxo-pentanoate
Description:
Ethyl 5-(2,3-difluorophenyl)-5-oxo-pentanoate is an organic compound characterized by its ester functional group, which is typical of many compounds in the ester category. The presence of the 2,3-difluorophenyl group indicates that the compound has two fluorine atoms substituted on a phenyl ring, which can influence its reactivity and physical properties, such as polarity and boiling point. The pentanoate portion of the molecule suggests a five-carbon chain with a ketone functionality, contributing to its overall structure and potential reactivity. This compound may exhibit interesting biological or chemical properties due to the presence of the fluorine atoms, which can enhance lipophilicity and metabolic stability. Ethyl 5-(2,3-difluorophenyl)-5-oxo-pentanoate may be of interest in pharmaceutical research or materials science, where fluorinated compounds often play a significant role. Its specific applications and behavior would depend on further studies, including its synthesis, stability, and interactions with other chemical entities.
Formula:C13H14F2O3
InChI:InChI=1/C13H14F2O3/c1-2-18-12(17)8-4-7-11(16)9-5-3-6-10(14)13(9)15/h3,5-6H,2,4,7-8H2,1H3
SMILES:CCOC(=O)CCCC(=O)c1cccc(c1F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.