CAS 898753-04-3
:ethyl 8-(2,3-difluorophenyl)-8-oxo-octanoate
Description:
Ethyl 8-(2,3-difluorophenyl)-8-oxo-octanoate is an organic compound characterized by its ester functional group, which is derived from octanoic acid and ethyl alcohol. The presence of the 2,3-difluorophenyl group introduces unique electronic and steric properties, potentially influencing its reactivity and interactions in chemical processes. The compound features a carbonyl group (C=O) adjacent to the octanoate chain, contributing to its ketone characteristics. This structure may impart specific biological activities, making it of interest in pharmaceutical research. The fluorine substituents can enhance lipophilicity and metabolic stability, which are critical factors in drug design. Ethyl 8-(2,3-difluorophenyl)-8-oxo-octanoate is likely to be a solid or liquid at room temperature, depending on its molecular weight and intermolecular forces. Its synthesis and applications may involve various organic reactions, including esterification and acylation. As with many organic compounds, safety data sheets should be consulted for handling and storage guidelines, as well as potential hazards associated with its use.
Formula:C16H20F2O3
InChI:InChI=1/C16H20F2O3/c1-2-21-15(20)11-6-4-3-5-10-14(19)12-8-7-9-13(17)16(12)18/h7-9H,2-6,10-11H2,1H3
SMILES:CCOC(=O)CCCCCCC(=O)c1cccc(c1F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.