CAS 898753-16-7
:ethyl 5-(2,5-difluorophenyl)-5-oxo-pentanoate
Description:
Ethyl 5-(2,5-difluorophenyl)-5-oxo-pentanoate, with the CAS number 898753-16-7, is an organic compound characterized by its ester functional group and a distinctive pentanoate backbone. The presence of a 2,5-difluorophenyl substituent indicates that the compound has two fluorine atoms attached to a phenyl ring, which can influence its chemical reactivity and physical properties, such as polarity and solubility. The oxo group (carbonyl) at the 5-position of the pentanoate chain contributes to the compound's potential reactivity, making it a candidate for various chemical transformations. Ethyl esters generally exhibit moderate volatility and are often used in organic synthesis and as intermediates in the production of pharmaceuticals and agrochemicals. The fluorine substituents can enhance the compound's biological activity and lipophilicity, making it of interest in medicinal chemistry. Overall, this compound's unique structure suggests potential applications in drug development and materials science, although specific properties such as melting point, boiling point, and solubility would require empirical measurement or detailed literature reference.
Formula:C13H14F2O3
InChI:InChI=1/C13H14F2O3/c1-2-18-13(17)5-3-4-12(16)10-8-9(14)6-7-11(10)15/h6-8H,2-5H2,1H3
SMILES:CCOC(=O)CCCC(=O)c1cc(ccc1F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.