CAS 898753-30-5

Ethyl 2,6-difluoro-η-oxobenzeneoctanoate

Description:

Ethyl 2,6-difluoro-η-oxobenzeneoctanoate, identified by its CAS number 898753-30-5, is a chemical compound that features a complex structure incorporating both an ethyl ester and a difluorobenzene moiety. This compound is characterized by the presence of two fluorine atoms at the 2 and 6 positions of the benzene ring, which can significantly influence its chemical reactivity and physical properties, such as polarity and lipophilicity. The ethyl ester functional group contributes to its potential applications in organic synthesis and medicinal chemistry. The presence of the octanoate chain suggests that it may exhibit interesting biological properties, possibly affecting its solubility and interaction with biological membranes. Additionally, the unique combination of functional groups may impart specific characteristics such as stability under various conditions, reactivity with nucleophiles, and potential for further derivatization. Overall, this compound's unique structure positions it as a candidate for research in various fields, including pharmaceuticals and materials science.

Formula: C₁₆H₂₀F₂O₃

InChI: InChI=1S/C16H20F2O3/c1-2-21-15(20)11-6-4-3-5-10-14(19)16-12(17)8-7-9-13(16)18/h7-9H,2-6,10-11H2,1H3

InChI key: InChIKey=DNBAZILRQDACTK-UHFFFAOYSA-N

SMILES: C(CCCCCCC(OCC)=O)(=O)C1=C(F)C=CC=C1F

Synonyms:

• Benzeneoctanoic acid, 2,6-difluoro-η-oxo-, ethyl ester
• Ethyl 2,6-difluoro-η-oxobenzeneoctanoate

ethyl 8-(2,6-difluorophenyl)-8-oxooctanoate

CAS: 898753-30-5

Formula: C₁₆H₂₀F₂O₃

Purity: 97.0%

Molecular weight: 298.33

Ref: 10-F207802