CAS 898753-35-0

Ethyl 2-fluoro-δ-oxobenzenepentanoate

Description:

Ethyl 2-fluoro-δ-oxobenzenepentanoate is an organic compound characterized by its ester functional group, which is derived from the reaction of a carboxylic acid and an alcohol. This compound features a fluoro substituent, indicating the presence of a fluorine atom, which can influence its reactivity and physical properties. The presence of the δ-oxobenzene moiety suggests that it contains a ketone functional group adjacent to a benzene ring, contributing to its potential reactivity and stability. Ethyl 2-fluoro-δ-oxobenzenepentanoate may exhibit moderate polarity due to the ester and fluoro groups, affecting its solubility in various solvents. Additionally, the compound's structure may allow for interesting interactions in biological systems, making it a candidate for further research in medicinal chemistry or material science. Its CAS number, 898753-35-0, provides a unique identifier for regulatory and safety information, which is essential for handling and application in laboratory settings.

Formula: C₁₃H₁₅FO₃

InChI: InChI=1S/C13H15FO3/c1-2-17-13(16)9-5-8-12(15)10-6-3-4-7-11(10)14/h3-4,6-7H,2,5,8-9H2,1H3

InChI key: InChIKey=JWDJUKXKHBKNFO-UHFFFAOYSA-N

SMILES: C(CCCC(OCC)=O)(=O)C1=C(F)C=CC=C1

Synonyms:

• Ethyl 2-fluoro-δ-oxobenzenepentanoate
• Benzenepentanoic acid, 2-fluoro-δ-oxo-, ethyl ester