CAS 898753-41-8
:ethyl 7-(2-fluorophenyl)-7-oxo-heptanoate
Description:
Ethyl 7-(2-fluorophenyl)-7-oxo-heptanoate is an organic compound characterized by its ester functional group, which is derived from the reaction of a carboxylic acid and an alcohol. This compound features a heptanoate backbone, indicating it has a seven-carbon chain, with a ketone group (7-oxo) and a fluorophenyl substituent at the 7-position. The presence of the fluorine atom in the phenyl ring can influence the compound's reactivity, polarity, and biological activity, making it of interest in medicinal chemistry and drug design. Ethyl esters typically exhibit moderate volatility and solubility in organic solvents, while their physical properties can vary based on the substituents attached to the carbon chain. The compound's structure suggests potential applications in pharmaceuticals, particularly in the development of compounds with specific biological activities. As with many organic compounds, safety and handling precautions should be observed, especially considering the presence of fluorine, which can impart unique toxicological properties.
Formula:C15H19FO3
InChI:InChI=1/C15H19FO3/c1-2-19-15(18)11-5-3-4-10-14(17)12-8-6-7-9-13(12)16/h6-9H,2-5,10-11H2,1H3
SMILES:CCOC(=O)CCCCCC(=O)c1ccccc1F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.