CAS 898753-48-5

1-Propanone, 1-(2,3-dimethylphenyl)-3-(2,5-dimethylphenyl)-

Description:

1-Propanone, 1-(2,3-dimethylphenyl)-3-(2,5-dimethylphenyl)-, also known by its CAS number 898753-48-5, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with two distinct aromatic substituents: a 2,3-dimethylphenyl group and a 2,5-dimethylphenyl group. The presence of these bulky aromatic rings contributes to its unique physical and chemical properties, such as increased molecular weight and potential for varied reactivity. Typically, compounds of this nature exhibit moderate volatility and may have a characteristic odor. They are often soluble in organic solvents but may have limited solubility in water due to their hydrophobic nature. The compound's structure suggests potential applications in organic synthesis, particularly in the development of pharmaceuticals or as intermediates in chemical reactions. Additionally, the presence of multiple methyl groups can influence the compound's stability and reactivity, making it of interest in various chemical research fields.

Formula: C₁₉H₂₂O

InChI: InChI=1S/C19H22O/c1-13-8-9-15(3)17(12-13)10-11-19(20)18-7-5-6-14(2)16(18)4/h5-9,12H,10-11H2,1-4H3

InChI key: InChIKey=XSGZZUBAKKQXQH-UHFFFAOYSA-N

SMILES: C(CCC1=C(C)C=CC(C)=C1)(=O)C2=C(C)C(C)=CC=C2

Synonyms:

• 2′,3′-Dimethyl-3-(2,5-dimethylphenyl)propiophenone
• 1-Propanone, 1-(2,3-dimethylphenyl)-3-(2,5-dimethylphenyl)-
• 1-(2,3-Dimethylphenyl)-3-(2,5-dimethylphenyl)-1-propanone