CymitQuimica logo

CAS 898753-51-0

:

1-Propanone, 1-(2,4-dimethylphenyl)-3-(2,5-dimethylphenyl)-

Description:
1-Propanone, 1-(2,4-dimethylphenyl)-3-(2,5-dimethylphenyl)-, also known by its CAS number 898753-51-0, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with two aromatic substituents, specifically 2,4-dimethylphenyl and 2,5-dimethylphenyl groups, which contribute to its chemical properties and reactivity. The presence of these bulky aromatic rings can influence the compound's solubility, boiling point, and overall stability. Typically, compounds of this nature exhibit moderate volatility and may have distinct odor characteristics. They are often utilized in organic synthesis and may serve as intermediates in the production of various chemical products. Additionally, the presence of multiple methyl groups can enhance the compound's hydrophobicity, affecting its interactions in biological systems and its potential applications in materials science or pharmaceuticals. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C19H22O
InChI:InChI=1S/C19H22O/c1-13-6-9-18(16(4)11-13)19(20)10-8-17-12-14(2)5-7-15(17)3/h5-7,9,11-12H,8,10H2,1-4H3
InChI key:InChIKey=ZNHLNUXKGKXQHU-UHFFFAOYSA-N
SMILES:C(CC(=O)C1=C(C)C=C(C)C=C1)C2=C(C)C=CC(C)=C2
Synonyms:
  • 2′,4′-Dimethyl-3-(2,5-dimethylphenyl)propiophenone
  • 1-Propanone, 1-(2,4-dimethylphenyl)-3-(2,5-dimethylphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.