CAS 898753-54-3

1,3-bis(2,5-dimethylphenyl)propan-1-one

Description:

1,3-bis(2,5-dimethylphenyl)propan-1-one, identified by its CAS number 898753-54-3, is an organic compound that belongs to the class of ketones. It features a propanone backbone with two 2,5-dimethylphenyl groups attached at the 1 and 3 positions, contributing to its unique structural characteristics. This compound is typically a solid at room temperature and exhibits a relatively high melting point due to the presence of bulky aromatic groups, which enhance its stability. It is often utilized in organic synthesis and as a photoinitiator in polymer chemistry, particularly in UV-curable systems. The presence of multiple methyl groups on the phenyl rings increases its hydrophobicity and may influence its solubility in various organic solvents. Additionally, its chemical structure allows for potential applications in materials science and the development of advanced coatings. Safety data should be consulted for handling, as with many organic compounds, it may pose health risks if not managed properly.

Formula: C₁₉H₂₂O

InChI: InChI=1/C19H22O/c1-13-5-7-15(3)17(11-13)9-10-19(20)18-12-14(2)6-8-16(18)4/h5-8,11-12H,9-10H2,1-4H3

SMILES: Cc1ccc(C)c(CCC(=O)c2cc(C)ccc2C)c1

2′,5′-dimethyl-3-(2,5-dimethylphenyl)propiophenone

CAS: 898753-54-3

Formula: C₁₉H₂₂O

Purity: 97.0%

Molecular weight: 266.384

Ref: 10-F206488