CymitQuimica logo

CAS 898753-57-6

:

1-Propanone, 3-(2,5-dimethylphenyl)-1-(2,6-dimethylphenyl)-

Description:
1-Propanone, 3-(2,5-dimethylphenyl)-1-(2,6-dimethylphenyl)-, also known by its CAS number 898753-57-6, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with two distinct aromatic substituents: a 2,5-dimethylphenyl group and a 2,6-dimethylphenyl group. The presence of these bulky aromatic rings contributes to its unique physical and chemical properties, including its potential solubility in organic solvents and its stability under various conditions. The compound may exhibit moderate volatility and can participate in various chemical reactions typical of ketones, such as nucleophilic addition. Its structural complexity suggests potential applications in organic synthesis or as an intermediate in the production of more complex molecules. However, specific data regarding its reactivity, toxicity, and environmental impact would require further investigation and analysis. Overall, this compound represents a specific class of ketones with potential utility in chemical research and industrial applications.
Formula:C19H22O
InChI:InChI=1S/C19H22O/c1-13-8-9-14(2)17(12-13)10-11-18(20)19-15(3)6-5-7-16(19)4/h5-9,12H,10-11H2,1-4H3
InChI key:InChIKey=PGWGFKZEEWVVTR-UHFFFAOYSA-N
SMILES:C(CCC1=C(C)C=CC(C)=C1)(=O)C2=C(C)C=CC=C2C
Synonyms:
  • 1-Propanone, 3-(2,5-dimethylphenyl)-1-(2,6-dimethylphenyl)-
  • 2′,6′-Dimethyl-3-(2,5-dimethylphenyl)propiophenone
  • 3-(2,5-Dimethylphenyl)-1-(2,6-dimethylphenyl)-1-propanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.