CAS 898753-62-3
:Ethyl 3,5-difluoro-α,α-dimethyl-γ-oxobenzenebutanoate
Description:
Ethyl 3,5-difluoro-α,α-dimethyl-γ-oxobenzenebutanoate is an organic compound characterized by its complex structure, which includes a benzene ring substituted with two fluorine atoms at the 3 and 5 positions, as well as a γ-oxobutanoate moiety. This compound features an ethyl ester functional group, contributing to its reactivity and solubility properties. The presence of the difluoromethyl groups enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The α,α-dimethyl substitution indicates steric hindrance, which can affect the compound's conformation and interactions with biological targets. Ethyl 3,5-difluoro-α,α-dimethyl-γ-oxobenzenebutanoate may exhibit unique chemical properties, such as stability under certain conditions and potential reactivity with nucleophiles or electrophiles. Its CAS number, 898753-62-3, allows for precise identification in chemical databases, facilitating research and application in various fields, including pharmaceuticals and agrochemicals.
Formula:C14H16F2O3
InChI:InChI=1S/C14H16F2O3/c1-4-19-13(18)14(2,3)8-12(17)9-5-10(15)7-11(16)6-9/h5-7H,4,8H2,1-3H3
InChI key:InChIKey=GBETYUOFHRBTHQ-UHFFFAOYSA-N
SMILES:C(CC(C(OCC)=O)(C)C)(=O)C1=CC(F)=CC(F)=C1
Synonyms:- Benzenebutanoic acid, 3,5-difluoro-α,α-dimethyl-γ-oxo-, ethyl ester
- Ethyl 3,5-difluoro-α,α-dimethyl-γ-oxobenzenebutanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.