CymitQuimica logo

CAS 898753-75-8

:

1-Propanone, 1-(2-chlorophenyl)-3-(2,5-dimethylphenyl)-

Description:
1-Propanone, 1-(2-chlorophenyl)-3-(2,5-dimethylphenyl)-, also known by its CAS number 898753-75-8, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: a 2-chlorophenyl group and a 2,5-dimethylphenyl group. The presence of the chlorine atom introduces a polar characteristic, potentially influencing its reactivity and solubility in various solvents. The dimethyl groups on the second aromatic ring contribute to steric hindrance, which may affect the compound's overall reactivity and interactions with other molecules. Typically, compounds of this nature may exhibit properties such as moderate volatility and varying degrees of solubility in organic solvents. Additionally, the presence of multiple aromatic rings often suggests potential applications in organic synthesis, pharmaceuticals, or as intermediates in chemical reactions. However, specific physical and chemical properties such as boiling point, melting point, and solubility would require empirical data for precise characterization.
Formula:C17H17ClO
InChI:InChI=1S/C17H17ClO/c1-12-7-8-13(2)14(11-12)9-10-17(19)15-5-3-4-6-16(15)18/h3-8,11H,9-10H2,1-2H3
InChI key:InChIKey=KINNHMKJIXFMNK-UHFFFAOYSA-N
SMILES:C(CC(=O)C1=C(Cl)C=CC=C1)C2=C(C)C=CC(C)=C2
Synonyms:
  • 1-(2-Chlorophenyl)-3-(2,5-dimethylphenyl)-1-propanone
  • 1-Propanone, 1-(2-chlorophenyl)-3-(2,5-dimethylphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.