CAS 898753-78-1

1-Propanone, 3-(2,5-dimethylphenyl)-1-(2-fluorophenyl)-

Description:

1-Propanone, 3-(2,5-dimethylphenyl)-1-(2-fluorophenyl)-, also known by its CAS number 898753-78-1, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: a 2,5-dimethylphenyl group and a 2-fluorophenyl group. The presence of the fluorine atom introduces unique electronic properties, potentially enhancing its reactivity and influencing its physical properties, such as boiling and melting points. Typically, compounds of this nature exhibit moderate to high lipophilicity due to their aromatic content, which can affect their solubility in various solvents. Additionally, the steric hindrance introduced by the dimethyl groups may influence the compound's reactivity and interaction with biological systems. Overall, this compound may have applications in organic synthesis, medicinal chemistry, or as an intermediate in the production of more complex molecules, although specific applications would depend on further research and characterization.

Formula: C₁₇H₁₇FO

InChI: InChI=1S/C17H17FO/c1-12-7-8-13(2)14(11-12)9-10-17(19)15-5-3-4-6-16(15)18/h3-8,11H,9-10H2,1-2H3

InChI key: InChIKey=ITMUOMVKFVIXRI-UHFFFAOYSA-N

SMILES: C(CC(=O)C1=C(F)C=CC=C1)C2=C(C)C=CC(C)=C2

Synonyms:

• 1-Propanone, 3-(2,5-dimethylphenyl)-1-(2-fluorophenyl)-
• 3-(2,5-Dimethylphenyl)-1-(2-fluorophenyl)-1-propanone
• 3-(2,5-Dimethylphenyl)-2′-fluoropropiophenone