CAS 898753-81-6

3-(2,5-dimethylphenyl)-1-[2-(trifluoromethyl)phenyl]propan-1-one

Description:

3-(2,5-Dimethylphenyl)-1-[2-(trifluoromethyl)phenyl]propan-1-one, with the CAS number 898753-81-6, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone, which is substituted with a 2,5-dimethylphenyl group and a 2-(trifluoromethyl)phenyl group, contributing to its unique chemical properties. The presence of the trifluoromethyl group enhances its lipophilicity and can influence its reactivity and biological activity. The compound is likely to exhibit moderate to high stability under standard conditions, but its reactivity may vary depending on the presence of specific functional groups and environmental factors. It may be utilized in various applications, including organic synthesis and as an intermediate in the production of pharmaceuticals or agrochemicals. Safety data should be consulted for handling and storage, as compounds with trifluoromethyl groups can exhibit specific toxicological profiles. Overall, this compound represents a complex structure with potential utility in chemical research and industry.

Formula: C₁₈H₁₇F₃O

InChI: InChI=1/C18H17F3O/c1-12-7-8-13(2)14(11-12)9-10-17(22)15-5-3-4-6-16(15)18(19,20)21/h3-8,11H,9-10H2,1-2H3

SMILES: Cc1ccc(C)c(CCC(=O)c2ccccc2C(F)(F)F)c1