CAS 898753-83-8
:Ethyl γ-oxocyclopentanebutanoate
Description:
Ethyl γ-oxocyclopentanebutanoate, identified by its CAS number 898753-83-8, is an organic compound characterized by its ester functional group and a cyclopentane ring structure. This compound features a γ-oxo group, indicating the presence of a carbonyl (C=O) adjacent to the ester moiety, which contributes to its reactivity and potential applications in organic synthesis. Ethyl γ-oxocyclopentanebutanoate is typically a colorless to pale yellow liquid, exhibiting moderate volatility and solubility in organic solvents. Its molecular structure suggests it may participate in various chemical reactions, including nucleophilic additions and condensation reactions, making it valuable in the synthesis of more complex molecules. The presence of both ester and ketone functionalities allows for diverse reactivity patterns, which can be exploited in medicinal chemistry and materials science. As with many organic compounds, safety precautions should be observed when handling this substance, as it may pose health risks if inhaled or ingested.
Formula:C11H18O3
InChI:InChI=1S/C11H18O3/c1-2-14-11(13)8-7-10(12)9-5-3-4-6-9/h9H,2-8H2,1H3
InChI key:InChIKey=CGGDTMPBLMPVPC-UHFFFAOYSA-N
SMILES:C(CCC(OCC)=O)(=O)C1CCCC1
Synonyms:- Cyclopentanebutanoic acid, γ-oxo-, ethyl ester
- Ethyl γ-oxocyclopentanebutanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.