CAS 898753-88-3

1-(4-bromo-2-fluoro-phenyl)-3-(2,5-dimethylphenyl)propan-1-one

Description:

1-(4-bromo-2-fluoro-phenyl)-3-(2,5-dimethylphenyl)propan-1-one, with the CAS number 898753-88-3, is an organic compound characterized by its complex structure featuring a propanone backbone. This compound includes a phenyl group substituted with both a bromine and a fluorine atom, which contributes to its unique reactivity and potential applications in medicinal chemistry. The presence of the 2,5-dimethylphenyl group enhances its hydrophobic characteristics, influencing its solubility and interaction with biological systems. The bromine and fluorine substituents can affect the electronic properties of the molecule, potentially enhancing its biological activity or altering its pharmacokinetic profile. As a ketone, it may participate in various chemical reactions, including nucleophilic additions and reductions. The compound's specific properties, such as melting point, boiling point, and solubility, would depend on its molecular interactions and the presence of functional groups. Overall, this compound is of interest in research fields such as drug development and materials science due to its structural complexity and potential functional applications.

Formula: C₁₇H₁₆BrFO

InChI: InChI=1/C17H16BrFO/c1-11-3-4-12(2)13(9-11)5-8-17(20)15-7-6-14(18)10-16(15)19/h3-4,6-7,9-10H,5,8H2,1-2H3

SMILES: Cc1ccc(C)c(CCC(=O)c2ccc(cc2F)Br)c1