CymitQuimica logo

CAS 898753-92-9

:

1-(3-chloro-5-fluoro-phenyl)-3-(2,5-dimethylphenyl)propan-1-one

Description:
1-(3-Chloro-5-fluoro-phenyl)-3-(2,5-dimethylphenyl)propan-1-one, with the CAS number 898753-92-9, is an organic compound characterized by its ketone functional group, specifically a propanone structure. This compound features a complex aromatic system, incorporating both a chloro and a fluoro substituent on one phenyl ring, which can influence its reactivity and physical properties. The presence of the 2,5-dimethylphenyl group adds steric bulk and may affect the compound's solubility and interaction with biological systems. Typically, compounds of this nature may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The chlorofluorophenyl moiety can enhance lipophilicity, potentially impacting the compound's bioavailability. Additionally, the presence of multiple substituents can lead to unique electronic properties, influencing the compound's behavior in various chemical reactions. Overall, this compound's structural features suggest potential applications in pharmaceuticals or agrochemicals, although specific biological activity would require further investigation.
Formula:C17H16ClFO
InChI:InChI=1/C17H16ClFO/c1-11-3-4-12(2)13(7-11)5-6-17(20)14-8-15(18)10-16(19)9-14/h3-4,7-10H,5-6H2,1-2H3
SMILES:Cc1ccc(C)c(CCC(=O)c2cc(cc(c2)F)Cl)c1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.