CymitQuimica logo

CAS 898753-94-1

:

1-(4-chloro-2-fluoro-phenyl)-3-(2,5-dimethylphenyl)propan-1-one

Description:
1-(4-chloro-2-fluoro-phenyl)-3-(2,5-dimethylphenyl)propan-1-one, with the CAS number 898753-94-1, is an organic compound characterized by its complex structure, which includes a propanone functional group and two distinct aromatic rings. The presence of a chloro and a fluoro substituent on one of the phenyl rings contributes to its unique chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The compound's molecular structure suggests it may exhibit interesting electronic properties due to the electron-withdrawing effects of the halogen substituents. Additionally, the presence of the dimethyl groups on the second phenyl ring may influence steric hindrance and solubility characteristics. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would be influenced by its molecular interactions and the presence of functional groups. Overall, this compound's specific characteristics make it a subject of interest for further research and potential applications in synthetic chemistry.
Formula:C17H16ClFO
InChI:InChI=1/C17H16ClFO/c1-11-3-4-12(2)13(9-11)5-8-17(20)15-7-6-14(18)10-16(15)19/h3-4,6-7,9-10H,5,8H2,1-2H3
SMILES:Cc1ccc(C)c(CCC(=O)c2ccc(cc2F)Cl)c1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.