CAS 898753-96-3
:1-Propanone, 1-(2,3-dichlorophenyl)-3-(2,5-dimethylphenyl)-
Description:
1-Propanone, 1-(2,3-dichlorophenyl)-3-(2,5-dimethylphenyl)-, identified by CAS number 898753-96-3, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: a dichlorophenyl group and a dimethylphenyl group. The presence of chlorine atoms in the dichlorophenyl moiety contributes to its chemical reactivity and potential biological activity, while the dimethylphenyl group may influence its physical properties, such as solubility and melting point. Typically, compounds of this nature exhibit moderate to high lipophilicity due to their aromatic structures, which can affect their behavior in biological systems and their interactions with other chemical entities. The compound may be utilized in various applications, including pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis, although specific applications would depend on further research into its properties and reactivity. Safety and handling precautions should be observed, as with many chlorinated organic compounds, due to potential toxicity and environmental concerns.
Formula:C17H16Cl2O
InChI:InChI=1S/C17H16Cl2O/c1-11-6-7-12(2)13(10-11)8-9-16(20)14-4-3-5-15(18)17(14)19/h3-7,10H,8-9H2,1-2H3
InChI key:InChIKey=VRGQMGWHFVNXAM-UHFFFAOYSA-N
SMILES:C(CCC1=C(C)C=CC(C)=C1)(=O)C2=C(Cl)C(Cl)=CC=C2
Synonyms:- 2′,3′-Dichloro-3-(2,5-dimethylphenyl)propiophenone
- 1-Propanone, 1-(2,3-dichlorophenyl)-3-(2,5-dimethylphenyl)-
- 1-(2,3-Dichlorophenyl)-3-(2,5-dimethylphenyl)-1-propanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.