CAS 898753-98-5
:1-(2,4-dichlorophenyl)-3-(2,5-dimethylphenyl)propan-1-one
Description:
1-(2,4-Dichlorophenyl)-3-(2,5-dimethylphenyl)propan-1-one, identified by its CAS number 898753-98-5, is an organic compound that belongs to the class of ketones. This substance features a propanone backbone with two distinct aromatic substituents: a dichlorophenyl group and a dimethylphenyl group. The presence of the dichlorophenyl moiety contributes to its potential biological activity, as halogenated compounds often exhibit unique reactivity and interactions in biological systems. The dimethylphenyl group adds steric bulk, which can influence the compound's physical properties, such as solubility and melting point. Typically, compounds of this nature may be studied for their applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The specific characteristics, such as boiling point, melting point, and solubility, would depend on the molecular interactions and the overall structure of the compound. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper usage and risk management.
Formula:C17H16Cl2O
InChI:InChI=1/C17H16Cl2O/c1-11-3-4-12(2)13(9-11)5-8-17(20)15-7-6-14(18)10-16(15)19/h3-4,6-7,9-10H,5,8H2,1-2H3
SMILES:Cc1ccc(C)c(CCC(=O)c2ccc(cc2Cl)Cl)c1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.