CAS 898754-14-8
:1-Propanone, 1-(2,6-dichlorophenyl)-3-(2,5-dimethylphenyl)-
Description:
1-Propanone, 1-(2,6-dichlorophenyl)-3-(2,5-dimethylphenyl)-, also known by its CAS number 898754-14-8, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with two distinct aromatic substituents: a 2,6-dichlorophenyl group and a 2,5-dimethylphenyl group. The presence of chlorine atoms in the dichlorophenyl group introduces significant electronegativity, which can influence the compound's reactivity and polarity. The dimethyl groups on the second phenyl ring contribute to steric hindrance, potentially affecting the compound's interactions in chemical reactions. As a ketone, it is likely to exhibit typical ketone properties, such as being a polar solvent and participating in nucleophilic addition reactions. The compound's structure suggests potential applications in organic synthesis and materials science, although specific applications would depend on further research into its reactivity and properties. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C17H16Cl2O
InChI:InChI=1S/C17H16Cl2O/c1-11-6-7-12(2)13(10-11)8-9-16(20)17-14(18)4-3-5-15(17)19/h3-7,10H,8-9H2,1-2H3
InChI key:InChIKey=BNOHXYFBIAFFBY-UHFFFAOYSA-N
SMILES:C(CCC1=C(C)C=CC(C)=C1)(=O)C2=C(Cl)C=CC=C2Cl
Synonyms:- 1-Propanone, 1-(2,6-dichlorophenyl)-3-(2,5-dimethylphenyl)-
- 2′,6′-Dichloro-3-(2,5-dimethylphenyl)propiophenone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.