CymitQuimica logo

CAS 898754-17-1

:

3-(2-methylsulfanylphenyl)-1-phenyl-propan-1-one

Description:
3-(2-Methylsulfanylphenyl)-1-phenyl-propan-1-one, identified by its CAS number 898754-17-1, is an organic compound that belongs to the class of ketones. It features a propanone structure with a phenyl group and a 2-methylsulfanylphenyl substituent, contributing to its unique chemical properties. This compound is characterized by its relatively high molecular weight and specific functional groups, which influence its reactivity and solubility. The presence of the methylsulfanyl group suggests potential for interesting interactions in biological systems or in synthetic applications. Its structure may impart certain hydrophobic characteristics, affecting its solubility in polar versus non-polar solvents. Additionally, the compound may exhibit interesting photophysical properties, making it of interest in materials science or organic synthesis. As with many organic compounds, safety and handling precautions should be observed, as it may pose risks such as irritation or toxicity. Further studies would be necessary to fully elucidate its properties and potential applications in various fields, including pharmaceuticals and materials science.
Formula:C16H16OS
InChI:InChI=1/C16H16OS/c1-18-16-10-6-5-9-14(16)11-12-15(17)13-7-3-2-4-8-13/h2-10H,11-12H2,1H3
SMILES:CSc1ccccc1CCC(=O)c1ccccc1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.