CAS 898754-19-3
:3-(2-methylsulfanylphenyl)-1-(o-tolyl)propan-1-one
Description:
3-(2-Methylsulfanylphenyl)-1-(o-tolyl)propan-1-one, identified by its CAS number 898754-19-3, is an organic compound that belongs to the class of ketones. This substance features a propanone backbone with two distinct aromatic substituents: a 2-methylsulfanylphenyl group and an o-tolyl group. The presence of the methylsulfanyl group introduces a sulfur atom into the structure, which can influence the compound's reactivity and solubility. The compound is likely to exhibit moderate to high lipophilicity due to its aromatic rings, which can affect its biological activity and interaction with other molecules. Its molecular structure suggests potential applications in pharmaceuticals or as a synthetic intermediate in organic chemistry. Additionally, the compound may exhibit specific physical properties such as melting and boiling points, which would be influenced by its molecular weight and functional groups. Safety and handling precautions should be observed, as with any chemical substance, particularly those with potential biological activity.
Formula:C17H18OS
InChI:InChI=1/C17H18OS/c1-13-7-3-5-9-15(13)16(18)12-11-14-8-4-6-10-17(14)19-2/h3-10H,11-12H2,1-2H3
SMILES:Cc1ccccc1C(=O)CCc1ccccc1SC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.