CymitQuimica logo

CAS 898754-20-6

:

1-cyclopentyl-3-(2,5-dimethylphenyl)propan-1-one

Description:
1-Cyclopentyl-3-(2,5-dimethylphenyl)propan-1-one, with the CAS number 898754-20-6, is an organic compound characterized by its ketone functional group and a complex structure that includes a cyclopentyl ring and a substituted phenyl group. This compound typically exhibits a moderate to high molecular weight due to its multi-ring structure and branched alkyl chains. It is likely to be a solid or viscous liquid at room temperature, depending on its specific melting and boiling points. The presence of the cyclopentyl group contributes to its unique steric and electronic properties, which can influence its reactivity and interactions with other molecules. Additionally, the dimethyl substitution on the phenyl ring may enhance its hydrophobic characteristics, affecting its solubility in various solvents. This compound may be of interest in synthetic organic chemistry and could have applications in pharmaceuticals or materials science, although specific applications would depend on further research into its biological activity and chemical behavior.
Formula:C16H22O
InChI:InChI=1/C16H22O/c1-12-7-8-13(2)15(11-12)9-10-16(17)14-5-3-4-6-14/h7-8,11,14H,3-6,9-10H2,1-2H3
SMILES:Cc1ccc(C)c(CCC(=O)C2CCCC2)c1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.