CAS 898754-21-7

1-Propanone, 1-(3-methylphenyl)-3-[2-(methylthio)phenyl]-

Description:

1-Propanone, 1-(3-methylphenyl)-3-[2-(methylthio)phenyl]- is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two aromatic substituents: a 3-methylphenyl group and a 2-(methylthio)phenyl group. The presence of the methylthio group introduces sulfur into the molecular structure, which can influence the compound's reactivity and properties. Typically, compounds of this nature exhibit moderate to high lipophilicity due to their aromatic components, which can affect their solubility in organic solvents. Additionally, the presence of multiple functional groups may lead to interesting chemical behavior, including potential for electrophilic substitution reactions. The compound's molecular weight, boiling point, and melting point would be influenced by the specific arrangement of atoms and the presence of substituents. Overall, this compound may have applications in organic synthesis, pharmaceuticals, or materials science, depending on its specific properties and reactivity.

Formula: C₁₇H₁₈OS

InChI: InChI=1S/C17H18OS/c1-13-6-5-8-15(12-13)16(18)11-10-14-7-3-4-9-17(14)19-2/h3-9,12H,10-11H2,1-2H3

InChI key: InChIKey=CGWHVQVPKIKXGP-UHFFFAOYSA-N

SMILES: C(CC(=O)C1=CC(C)=CC=C1)C2=C(SC)C=CC=C2

Synonyms:

• 1-Propanone, 1-(3-methylphenyl)-3-[2-(methylthio)phenyl]-
• 1-(3-Methylphenyl)-3-[2-(methylsulfanyl)phenyl]-1-propanone