CAS 898754-24-0
:3-(2,6-dimethylphenyl)-1-phenyl-propan-1-one
Description:
3-(2,6-Dimethylphenyl)-1-phenyl-propan-1-one, also known by its CAS number 898754-24-0, is an organic compound that belongs to the class of ketones. It features a propanone structure with two aromatic rings, specifically a 2,6-dimethylphenyl group and a phenyl group, which contribute to its unique properties. This compound is typically characterized by its relatively high molecular weight and lipophilicity due to the presence of multiple aromatic rings. It may exhibit a solid or viscous liquid state at room temperature, depending on its specific formulation and purity. The presence of the ketone functional group suggests that it may participate in various chemical reactions, including nucleophilic additions and reductions. Additionally, its aromatic nature may impart stability and influence its reactivity. This compound is often utilized in organic synthesis and may have applications in the production of fragrances, pharmaceuticals, or as an intermediate in chemical manufacturing. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C17H18O
InChI:InChI=1/C17H18O/c1-13-7-6-8-14(2)16(13)11-12-17(18)15-9-4-3-5-10-15/h3-10H,11-12H2,1-2H3
SMILES:Cc1cccc(C)c1CCC(=O)c1ccccc1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.