CymitQuimica logo

CAS 898754-25-1

:

1-(2-methoxyphenyl)-3-(2-methylsulfanylphenyl)propan-1-one

Description:
1-(2-Methoxyphenyl)-3-(2-methylsulfanylphenyl)propan-1-one, identified by its CAS number 898754-25-1, is an organic compound characterized by its ketone functional group and the presence of aromatic rings. This compound features a propanone backbone, with substituents that include a methoxy group and a methylthio group, which contribute to its chemical properties and reactivity. The methoxy group typically enhances the compound's solubility in organic solvents and may influence its electronic properties, while the methylthio group can affect its steric and electronic characteristics. The presence of these functional groups suggests potential applications in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. Additionally, the compound's structure may exhibit interesting photophysical properties, making it a candidate for studies in materials science. As with many organic compounds, its stability, reactivity, and potential toxicity would need to be evaluated in specific contexts to ensure safe handling and application.
Formula:C17H18O2S
InChI:InChI=1/C17H18O2S/c1-19-16-9-5-4-8-14(16)15(18)12-11-13-7-3-6-10-17(13)20-2/h3-10H,11-12H2,1-2H3
SMILES:COc1ccccc1C(=O)CCc1ccccc1SC
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.