CAS 898754-27-3

1-(3-methoxyphenyl)-3-(2-methylsulfanylphenyl)propan-1-one

Description:

1-(3-Methoxyphenyl)-3-(2-methylsulfanylphenyl)propan-1-one, identified by its CAS number 898754-27-3, is an organic compound that belongs to the class of ketones. This substance features a propanone backbone with two distinct aromatic substituents: a methoxyphenyl group and a methylsulfanylphenyl group. The presence of the methoxy group (-OCH3) enhances its solubility in organic solvents and may influence its reactivity and interaction with biological systems. The methylsulfanyl group (-SCH3) introduces a sulfur atom, which can affect the compound's electronic properties and potential biological activity. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Its structural characteristics suggest potential applications in drug development, particularly in the design of compounds targeting specific biological pathways. However, detailed studies on its physical properties, such as melting point, boiling point, and solubility, as well as its biological activity, would be necessary to fully understand its potential uses and implications in various fields.

Formula: C₁₇H₁₈O₂S

InChI: InChI=1/C17H18O2S/c1-19-15-8-5-7-14(12-15)16(18)11-10-13-6-3-4-9-17(13)20-2/h3-9,12H,10-11H2,1-2H3

SMILES: COc1cccc(c1)C(=O)CCc1ccccc1SC