CAS 898754-29-5
:1-Propanone, 1-(4-methoxyphenyl)-3-[2-(methylthio)phenyl]-
Description:
1-Propanone, 1-(4-methoxyphenyl)-3-[2-(methylthio)phenyl]- is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: a para-methoxyphenyl group and a 2-(methylthio)phenyl group. The presence of the methoxy group enhances its electron-donating properties, potentially influencing its reactivity and solubility in organic solvents. The methylthio group introduces a sulfur atom, which can affect the compound's electronic properties and interactions with other molecules. Typically, compounds of this nature exhibit moderate to high lipophilicity due to their aromatic structures, which can facilitate their use in various applications, including pharmaceuticals and agrochemicals. Additionally, the compound may exhibit specific biological activities, making it of interest in medicinal chemistry. However, detailed studies on its physical properties, such as boiling point, melting point, and solubility, would be necessary to fully characterize its behavior in different environments.
Formula:C17H18O2S
InChI:InChI=1S/C17H18O2S/c1-19-15-10-7-13(8-11-15)16(18)12-9-14-5-3-4-6-17(14)20-2/h3-8,10-11H,9,12H2,1-2H3
InChI key:InChIKey=ZPSBGFXYGLKJBU-UHFFFAOYSA-N
SMILES:C(CC(=O)C1=CC=C(OC)C=C1)C2=C(SC)C=CC=C2
Synonyms:- 1-Propanone, 1-(4-methoxyphenyl)-3-[2-(methylthio)phenyl]-
- 1-(4-Methoxyphenyl)-3-[2-(methylsulfanyl)phenyl]-1-propanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.