CAS 898754-35-3
:Methanone, [2-(1-azetidinylmethyl)phenyl](2-methoxyphenyl)-
Description:
Methanone, [2-(1-azetidinylmethyl)phenyl](2-methoxyphenyl)-, identified by its CAS number 898754-35-3, is a chemical compound that features a ketone functional group, specifically a methanone structure. This compound is characterized by the presence of an azetidine ring, which is a four-membered saturated heterocyclic structure containing one nitrogen atom. The compound also includes a phenyl group substituted with a methoxy group, contributing to its overall aromatic character. The presence of these functional groups suggests potential biological activity, making it of interest in medicinal chemistry. Its molecular structure indicates that it may exhibit specific interactions with biological targets, potentially influencing its pharmacological properties. Additionally, the compound's solubility, stability, and reactivity can be influenced by the substituents on the aromatic rings and the azetidine moiety. Overall, this compound represents a unique structure that may have applications in drug development or other chemical research fields.
Formula:C18H19NO2
InChI:InChI=1/C18H19NO2/c1-21-17-10-5-4-9-16(17)18(20)15-8-3-2-7-14(15)13-19-11-6-12-19/h2-5,7-10H,6,11-13H2,1H3
InChI key:InChIKey=HMSIBDSAVRAREP-UHFFFAOYSA-N
SMILES:C(C1=C(C(=O)C2=C(OC)C=CC=C2)C=CC=C1)N3CCC3
Synonyms:- Methanone, [2-(1-azetidinylmethyl)phenyl](2-methoxyphenyl)-
- [2-(1-Azetidinylmethyl)phenyl](2-methoxyphenyl)methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.