CymitQuimica logo

CAS 898754-39-7

:

ethyl 2-[3-(2-methylsulfanylphenyl)propanoyl]benzoate

Description:
Ethyl 2-[3-(2-methylsulfanylphenyl)propanoyl]benzoate, identified by its CAS number 898754-39-7, is an organic compound characterized by its ester functional group, which is derived from benzoic acid and ethyl alcohol. This compound features a complex structure that includes a benzoate moiety and a propanoyl group attached to a phenyl ring substituted with a methylsulfanyl group. The presence of the methylsulfanyl group introduces unique properties, such as potential for increased lipophilicity and altered reactivity compared to similar compounds without sulfur substituents. Ethyl 2-[3-(2-methylsulfanylphenyl)propanoyl]benzoate may exhibit interesting biological activities, making it of interest in medicinal chemistry and drug development. Its solubility, stability, and reactivity can be influenced by the steric and electronic effects of the substituents on the aromatic rings. As with many organic compounds, safety and handling precautions should be observed, particularly regarding potential toxicity and environmental impact. Further studies would be necessary to fully elucidate its properties and applications.
Formula:C19H20O3S
InChI:InChI=1/C19H20O3S/c1-3-22-19(21)16-10-6-5-9-15(16)17(20)13-12-14-8-4-7-11-18(14)23-2/h4-11H,3,12-13H2,1-2H3
SMILES:CCOC(=O)c1ccccc1C(=O)CCc1ccccc1SC
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.