CAS 898754-42-2
:ethyl 3-[3-(2-methylsulfanylphenyl)propanoyl]benzoate
Description:
Ethyl 3-[3-(2-methylsulfanylphenyl)propanoyl]benzoate, identified by its CAS number 898754-42-2, is an organic compound that belongs to the class of esters. This substance features a complex structure characterized by a benzoate moiety linked to a propanoyl group, which is further substituted with a 2-methylsulfanylphenyl group. The presence of the ethyl group contributes to its ester classification, while the methylsulfanyl group introduces a sulfur atom, which can influence the compound's reactivity and solubility. Ethyl esters generally exhibit moderate volatility and can be soluble in organic solvents, making them useful in various applications, including as intermediates in organic synthesis or in the formulation of fragrances and flavorings. The specific arrangement of functional groups in this compound may also impart unique biological or chemical properties, which could be of interest in medicinal chemistry or material science. However, detailed studies would be necessary to fully understand its reactivity, stability, and potential applications.
Formula:C19H20O3S
InChI:InChI=1/C19H20O3S/c1-3-22-19(21)16-9-6-8-15(13-16)17(20)12-11-14-7-4-5-10-18(14)23-2/h4-10,13H,3,11-12H2,1-2H3
SMILES:CCOC(=O)c1cccc(c1)C(=O)CCc1ccccc1SC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.