CAS 898754-48-8

1-Propanone, 1,3-bis[2-(methylthio)phenyl]-

Description:

1-Propanone, 1,3-bis[2-(methylthio)phenyl]- is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two phenyl groups substituted at the 1 and 3 positions, each containing a methylthio group. The presence of the methylthio groups enhances its chemical reactivity and solubility in organic solvents. Typically, compounds of this nature exhibit moderate to high boiling points due to the presence of multiple aromatic rings, which contribute to stronger intermolecular forces. Additionally, the methylthio substituents can influence the compound's electronic properties, potentially making it useful in various applications, including organic synthesis and materials science. The compound's molecular structure suggests it may participate in electrophilic aromatic substitution reactions, and its unique characteristics could be explored in fields such as pharmaceuticals or agrochemicals. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₇H₁₈OS₂

InChI: InChI=1S/C17H18OS2/c1-19-16-9-5-3-7-13(16)11-12-15(18)14-8-4-6-10-17(14)20-2/h3-10H,11-12H2,1-2H3

InChI key: InChIKey=DRHFJUJINAHTJH-UHFFFAOYSA-N

SMILES: C(CCC1=C(SC)C=CC=C1)(=O)C2=C(SC)C=CC=C2

Synonyms:

• 1-Propanone, 1,3-bis[2-(methylthio)phenyl]-