CymitQuimica logo

CAS 898754-51-3

:

1-Propanone, 3-[2-(methylthio)phenyl]-1-[4-(methylthio)phenyl]-

Description:
1-Propanone, 3-[2-(methylthio)phenyl]-1-[4-(methylthio)phenyl]- is an organic compound characterized by its ketone functional group, specifically a propanone structure with substituents that include two methylthio groups attached to phenyl rings. This compound features a relatively complex molecular structure, which contributes to its unique chemical properties. The presence of the methylthio groups enhances its reactivity and may influence its solubility in various solvents. Typically, compounds of this nature exhibit moderate volatility and can participate in various chemical reactions, including nucleophilic additions and substitutions. The compound may also display interesting biological activities, making it of interest in pharmaceutical and agrochemical research. Its molecular interactions can be influenced by the steric and electronic effects of the methylthio groups, which can affect its behavior in different chemical environments. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C17H18OS2
InChI:InChI=1S/C17H18OS2/c1-19-15-10-7-13(8-11-15)16(18)12-9-14-5-3-4-6-17(14)20-2/h3-8,10-11H,9,12H2,1-2H3
InChI key:InChIKey=UFZMMXPUOXVLTE-UHFFFAOYSA-N
SMILES:C(CC(=O)C1=CC=C(SC)C=C1)C2=C(SC)C=CC=C2
Synonyms:
  • 3-[2-(Methylsulfanyl)phenyl]-1-[4-(methylsulfanyl)phenyl]-1-propanone
  • 1-Propanone, 3-[2-(methylthio)phenyl]-1-[4-(methylthio)phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.