CAS 898754-52-4

ethyl 3-[3-(2,6-dimethylphenyl)propanoyl]benzoate

Description:

Ethyl 3-[3-(2,6-dimethylphenyl)propanoyl]benzoate, with the CAS number 898754-52-4, is an organic compound characterized by its ester functional group, which is derived from benzoic acid and an ethyl alcohol moiety. This compound features a complex structure that includes a benzoate core, a propanoyl side chain, and a 2,6-dimethylphenyl substituent, contributing to its unique chemical properties. It is likely to exhibit moderate solubility in organic solvents due to its hydrophobic aromatic components, while its ester functionality may impart some degree of polarity. The presence of the bulky 2,6-dimethylphenyl group can influence its steric hindrance and reactivity, potentially affecting its interactions in chemical reactions or biological systems. Ethyl 3-[3-(2,6-dimethylphenyl)propanoyl]benzoate may be of interest in various applications, including pharmaceuticals, agrochemicals, or as a synthetic intermediate in organic chemistry. However, specific data regarding its physical properties, reactivity, and safety profile would require further investigation or reference to specialized databases.

Formula: C₂₀H₂₂O₃

InChI: InChI=1/C20H22O3/c1-4-23-20(22)17-10-6-9-16(13-17)19(21)12-11-18-14(2)7-5-8-15(18)3/h5-10,13H,4,11-12H2,1-3H3

SMILES: CCOC(=O)c1cccc(c1)C(=O)CCc1c(C)cccc1C