CAS 898754-54-6
:1-(3-Bromophenyl)-3-[2-(methylthio)phenyl]-1-propanone
Description:
1-(3-Bromophenyl)-3-[2-(methylthio)phenyl]-1-propanone, identified by its CAS number 898754-54-6, is an organic compound characterized by its complex structure featuring a propanone backbone. This compound contains a bromophenyl group and a methylthio-substituted phenyl group, contributing to its unique chemical properties. The presence of the bromine atom introduces significant electronegativity, which can influence the compound's reactivity and interactions with other molecules. The methylthio group enhances the compound's lipophilicity, potentially affecting its solubility in organic solvents. This compound may exhibit interesting biological activities due to its structural features, making it a subject of interest in medicinal chemistry and material science. Its synthesis typically involves multi-step organic reactions, and it may be utilized in various applications, including as an intermediate in the production of pharmaceuticals or agrochemicals. As with many organic compounds, safety precautions should be observed when handling this substance, as it may pose health risks or environmental hazards.
Formula:C16H15BrOS
InChI:InChI=1/C16H15BrOS/c1-19-16-8-3-2-5-12(16)9-10-15(18)13-6-4-7-14(17)11-13/h2-8,11H,9-10H2,1H3
InChI key:InChIKey=LZMXJNVJGITUDO-UHFFFAOYSA-N
SMILES:C(CC(=O)C1=CC(Br)=CC=C1)C2=C(SC)C=CC=C2
Synonyms:- 1-Propanone, 1-(3-bromophenyl)-3-[2-(methylthio)phenyl]-
- 1-(3-Bromophenyl)-3-[2-(methylthio)phenyl]-1-propanone
- 1-(3-Bromophenyl)-3-[2-(methylsulfanyl)phenyl]-1-propanone
- 3'-BROMO-3-(2-THIOMETHYLPHENYL)PROPIOPHENONE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.