CAS 898754-56-8

Ethyl 3-[2-(1-azetidinylmethyl)benzoyl]benzoate

Description:

Ethyl 3-[2-(1-azetidinylmethyl)benzoyl]benzoate is a chemical compound characterized by its unique structure, which includes an ethyl ester group and a benzoyl moiety linked to a 1-azetidinylmethyl substituent. This compound typically exhibits properties associated with esters, such as being a colorless to pale yellow liquid or solid, depending on its specific form and purity. It is likely to be soluble in organic solvents like ethanol and dichloromethane, while being less soluble in water due to its hydrophobic aromatic components. The presence of the azetidine ring suggests potential biological activity, as such structures are often found in pharmaceuticals and can interact with biological systems. Additionally, the compound may exhibit moderate to high stability under standard conditions, although it should be handled with care due to potential reactivity with strong acids or bases. Its specific applications would depend on ongoing research and development in medicinal chemistry or related fields.

Formula: C₂₀H₂₁NO₃

InChI: InChI=1/C20H21NO3/c1-2-24-20(23)16-9-5-8-15(13-16)19(22)18-10-4-3-7-17(18)14-21-11-6-12-21/h3-5,7-10,13H,2,6,11-12,14H2,1H3

InChI key: InChIKey=XRZNANMAVAUXJN-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(CN2CCC2)C=CC=C1)C3=CC(C(OCC)=O)=CC=C3

Synonyms:

• Benzoic acid, 3-[2-(1-azetidinylmethyl)benzoyl]-, ethyl ester
• Ethyl 3-[2-(1-azetidinylmethyl)benzoyl]benzoate
• 2-AZETIDINOMETHYL-3'-CARBOETHOXYBENZOPHENONE