CAS 898754-57-9

1-(4-bromophenyl)-3-(2-methylsulfanylphenyl)propan-1-one

Description:

1-(4-bromophenyl)-3-(2-methylsulfanylphenyl)propan-1-one, with the CAS number 898754-57-9, is an organic compound characterized by its ketone functional group and the presence of bromine and a methylthio group. This compound features a propanone backbone, which is substituted at the first position with a 4-bromophenyl group and at the third position with a 2-methylsulfanylphenyl group. The presence of the bromine atom introduces significant electronegativity, potentially influencing the compound's reactivity and polarity. The methylthio group can enhance the compound's lipophilicity, affecting its solubility in organic solvents. This compound may exhibit interesting biological activities due to its structural features, making it a subject of interest in medicinal chemistry and material science. Its synthesis typically involves multi-step organic reactions, and it may be utilized in various applications, including pharmaceuticals and agrochemicals. As with many organic compounds, safety precautions should be observed when handling this substance, considering potential toxicity and environmental impact.

Formula: C₁₆H₁₅BrOS

InChI: InChI=1/C16H15BrOS/c1-19-16-5-3-2-4-13(16)8-11-15(18)12-6-9-14(17)10-7-12/h2-7,9-10H,8,11H2,1H3

SMILES: CSc1ccccc1CCC(=O)c1ccc(cc1)Br