CymitQuimica logo

CAS 898754-60-4

:

1-Propanone, 1-(3-chlorophenyl)-3-[2-(methylthio)phenyl]-

Description:
1-Propanone, 1-(3-chlorophenyl)-3-[2-(methylthio)phenyl]- is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with substituents that include a 3-chlorophenyl group and a 2-(methylthio)phenyl group, contributing to its unique chemical properties. The presence of the chlorine atom introduces electronegativity, which can influence the compound's reactivity and polarity. The methylthio group enhances the compound's potential for various chemical interactions, particularly in nucleophilic substitution reactions. This compound may exhibit moderate solubility in organic solvents and is likely to have specific applications in pharmaceuticals or as an intermediate in organic synthesis. Its molecular structure suggests potential for biological activity, although specific biological properties would require further investigation. Safety data and handling precautions should be observed, as with any chemical substance, particularly those with halogenated groups.
Formula:C16H15ClOS
InChI:InChI=1S/C16H15ClOS/c1-19-16-8-3-2-5-12(16)9-10-15(18)13-6-4-7-14(17)11-13/h2-8,11H,9-10H2,1H3
InChI key:InChIKey=YJUYKPMBGPENQS-UHFFFAOYSA-N
SMILES:C(CC(=O)C1=CC(Cl)=CC=C1)C2=C(SC)C=CC=C2
Synonyms:
  • 1-(3-Chlorophenyl)-3-[2-(methylsulfanyl)phenyl]-1-propanone
  • 1-Propanone, 1-(3-chlorophenyl)-3-[2-(methylthio)phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.