CymitQuimica logo

CAS 898754-62-6

:

Methanone, [2-(1-azetidinylmethyl)phenyl][2-(methylthio)phenyl]-

Description:
Methanone, [2-(1-azetidinylmethyl)phenyl][2-(methylthio)phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and two distinct aromatic rings. The presence of an azetidine ring indicates that it has a cyclic amine structure, contributing to its potential biological activity. The methylthio group attached to one of the phenyl rings suggests that the compound may exhibit unique electronic properties and reactivity due to the sulfur atom's influence. This compound is likely to be of interest in medicinal chemistry, particularly for its potential pharmacological applications, as compounds with similar structures often show activity against various biological targets. Its molecular interactions, solubility, and stability would depend on the specific arrangement of its functional groups and the overall three-dimensional conformation. As with many organic compounds, understanding its characteristics requires consideration of its synthesis, reactivity, and potential applications in various fields, including pharmaceuticals and materials science.
Formula:C18H19NOS
InChI:InChI=1S/C18H19NOS/c1-21-17-10-5-4-9-16(17)18(20)15-8-3-2-7-14(15)13-19-11-6-12-19/h2-5,7-10H,6,11-13H2,1H3
InChI key:InChIKey=NBBXAXTUDMEHIL-UHFFFAOYSA-N
SMILES:C(C1=C(C(=O)C2=C(SC)C=CC=C2)C=CC=C1)N3CCC3
Synonyms:
  • Methanone, [2-(1-azetidinylmethyl)phenyl][2-(methylthio)phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.