CAS 898754-63-7

1-Propanone, 1-(4-chlorophenyl)-3-[2-(methylthio)phenyl]-

Description:

1-Propanone, 1-(4-chlorophenyl)-3-[2-(methylthio)phenyl]- is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with a 4-chlorophenyl group and a 2-(methylthio)phenyl substituent, contributing to its unique chemical properties. The presence of the chlorophenyl group introduces electron-withdrawing characteristics, which can influence the compound's reactivity and stability. The methylthio group adds a sulfur atom, which can enhance the compound's lipophilicity and potentially affect its biological activity. This compound is likely to be a solid or liquid at room temperature, depending on its molecular weight and intermolecular interactions. It may exhibit moderate solubility in organic solvents, while its solubility in water is expected to be low due to its hydrophobic nature. As with many organic compounds, it is essential to handle it with care, considering potential toxicity and environmental impact. Overall, this compound's unique structure suggests potential applications in pharmaceuticals or materials science, warranting further investigation into its properties and uses.

Formula: C₁₆H₁₅ClOS

InChI: InChI=1S/C16H15ClOS/c1-19-16-5-3-2-4-13(16)8-11-15(18)12-6-9-14(17)10-7-12/h2-7,9-10H,8,11H2,1H3

InChI key: InChIKey=NEBKOZTXQNNIAZ-UHFFFAOYSA-N

SMILES: C(CC(=O)C1=CC=C(Cl)C=C1)C2=C(SC)C=CC=C2

Synonyms:

• 1-(4-Chlorophenyl)-3-[2-(methylsulfanyl)phenyl]-1-propanone
• 1-Propanone, 1-(4-chlorophenyl)-3-[2-(methylthio)phenyl]-