CAS 898754-64-8

1-Propanone, 1-(3-bromophenyl)-3-(2,6-dimethylphenyl)-

Description:

1-Propanone, 1-(3-bromophenyl)-3-(2,6-dimethylphenyl)-, also known by its CAS number 898754-64-8, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: a bromophenyl group and a dimethylphenyl group. The presence of the bromine atom introduces notable electronegative characteristics, potentially influencing the compound's reactivity and polarity. The dimethyl groups on the phenyl ring contribute to steric hindrance, which can affect the compound's interactions in chemical reactions. Typically, compounds of this nature exhibit moderate solubility in organic solvents and may have varying degrees of stability depending on environmental conditions. The presence of multiple aromatic rings suggests potential applications in materials science or pharmaceuticals, where such structures can exhibit interesting electronic properties. Overall, the unique combination of functional groups and substituents in this compound makes it a subject of interest in organic synthesis and chemical research.

Formula: C₁₇H₁₇BrO

InChI: InChI=1S/C17H17BrO/c1-12-5-3-6-13(2)16(12)9-10-17(19)14-7-4-8-15(18)11-14/h3-8,11H,9-10H2,1-2H3

InChI key: InChIKey=XXGRTVZQGVPIMM-UHFFFAOYSA-N

SMILES: C(CCC1=C(C)C=CC=C1C)(=O)C2=CC(Br)=CC=C2

Synonyms:

• 1-Propanone, 1-(3-bromophenyl)-3-(2,6-dimethylphenyl)-
• 3′-Bromo-3-(2,6-dimethylphenyl)propiophenone

3′-bromo-3-(2,6-dimethylphenyl)propiophenone

CAS: 898754-64-8

Formula: C₁₇H₁₇BrO

Purity: 97.0%

Molecular weight: 317.226

Ref: 10-F206533