CAS 898754-65-9

Methanone, [2-(1-azetidinylmethyl)phenyl][4-(methylthio)phenyl]-

Description:

Methanone, [2-(1-azetidinylmethyl)phenyl][4-(methylthio)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and two distinct aromatic rings. The presence of an azetidine ring contributes to its potential biological activity, as azetidines are often found in various pharmaceuticals. The compound features a methylthio group, which can influence its solubility and reactivity, making it of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, possibly affecting its pharmacological properties. The compound's CAS number, 898754-65-9, allows for easy identification in chemical databases and literature. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would depend on the specific arrangement of atoms and the presence of functional groups. Overall, this compound may have applications in drug development or as a research tool in studying biological processes.

Formula: C₁₈H₁₉NOS

InChI: InChI=1S/C18H19NOS/c1-21-16-9-7-14(8-10-16)18(20)17-6-3-2-5-15(17)13-19-11-4-12-19/h2-3,5-10H,4,11-13H2,1H3

InChI key: InChIKey=PPEQEZAEFDKMJD-UHFFFAOYSA-N

SMILES: C(C1=C(C(=O)C2=CC=C(SC)C=C2)C=CC=C1)N3CCC3

Synonyms:

• Methanone, [2-(1-azetidinylmethyl)phenyl][4-(methylthio)phenyl]-
• [2-(1-Azetidinylmethyl)phenyl][4-(methylsulfanyl)phenyl]methanone