CymitQuimica logo

CAS 898754-66-0

:

1-(3-fluorophenyl)-3-(2-methylsulfanylphenyl)propan-1-one

Description:
1-(3-fluorophenyl)-3-(2-methylsulfanylphenyl)propan-1-one, with the CAS number 898754-66-0, is an organic compound characterized by its ketone functional group and the presence of both fluorine and sulfur substituents on its aromatic rings. This compound features a propanone backbone, which contributes to its reactivity and potential applications in organic synthesis. The 3-fluorophenyl group introduces electron-withdrawing characteristics due to the fluorine atom, potentially influencing the compound's reactivity and interaction with biological systems. The 2-methylsulfanylphenyl group adds a methylthio substituent, which can enhance lipophilicity and alter the compound's solubility in various solvents. Overall, this compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. Its unique structural features suggest potential applications in various fields, including pharmaceuticals and agrochemicals, although specific biological activities would require further investigation through experimental studies.
Formula:C16H15FOS
InChI:InChI=1/C16H15FOS/c1-19-16-8-3-2-5-12(16)9-10-15(18)13-6-4-7-14(17)11-13/h2-8,11H,9-10H2,1H3
InChI key:InChIKey=RLUWJLDENVQFBS-UHFFFAOYSA-N
SMILES:C(CC(=O)C1=CC(F)=CC=C1)C2=C(SC)C=CC=C2
Synonyms:
  • 1-(3-Fluorophenyl)-3-[2-(methylsulfanyl)phenyl]-1-propanone
  • 1-Propanone, 1-(3-fluorophenyl)-3-[2-(methylthio)phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.