CAS 898754-69-3

1-(4-fluorophenyl)-3-(2-methylsulfanylphenyl)propan-1-one

Description:

1-(4-fluorophenyl)-3-(2-methylsulfanylphenyl)propan-1-one, with the CAS number 898754-69-3, is an organic compound characterized by its ketone functional group and the presence of both fluorine and sulfur substituents on its aromatic rings. This compound features a propanone backbone, which contributes to its reactivity and potential applications in organic synthesis. The presence of the 4-fluorophenyl group enhances its electronic properties, potentially influencing its interactions in biological systems or chemical reactions. The 2-methylsulfanylphenyl moiety introduces a sulfur atom, which can affect the compound's solubility and stability. Typically, compounds of this nature may exhibit interesting pharmacological properties, making them subjects of interest in medicinal chemistry. Additionally, the structural features suggest potential for various synthetic modifications, which could lead to derivatives with altered biological or chemical activity. Overall, this compound exemplifies the complexity and diversity of organic molecules used in research and industry.

Formula: C₁₆H₁₅FOS

InChI: InChI=1/C16H15FOS/c1-19-16-5-3-2-4-13(16)8-11-15(18)12-6-9-14(17)10-7-12/h2-7,9-10H,8,11H2,1H3

SMILES: CSc1ccccc1CCC(=O)c1ccc(cc1)F