CAS 898754-71-7
:Methanone, [2-(1-azetidinylmethyl)phenyl](4-bromophenyl)-
Description:
Methanone, [2-(1-azetidinylmethyl)phenyl](4-bromophenyl)-, also known by its CAS number 898754-71-7, is a chemical compound characterized by its unique structure that includes a methanone functional group and an azetidine ring. This compound features a phenyl group substituted with a bromine atom, which can influence its reactivity and physical properties. The presence of the azetidine moiety suggests potential applications in medicinal chemistry, as azetidines are often found in biologically active compounds. The compound's molecular structure likely contributes to its solubility, stability, and interaction with biological targets. Additionally, the bromine substituent may enhance its lipophilicity, affecting its pharmacokinetic properties. As with many organic compounds, the specific characteristics such as melting point, boiling point, and solubility would depend on the molecular interactions and the environment in which the compound is studied. Overall, this compound represents a class of organic molecules that may have significant implications in drug development and synthetic chemistry.
Formula:C17H16BrNO
InChI:InChI=1S/C17H16BrNO/c18-15-8-6-13(7-9-15)17(20)16-5-2-1-4-14(16)12-19-10-3-11-19/h1-2,4-9H,3,10-12H2
InChI key:InChIKey=LNLAGRHPLVVVTB-UHFFFAOYSA-N
SMILES:C(C1=C(C(=O)C2=CC=C(Br)C=C2)C=CC=C1)N3CCC3
Synonyms:- [2-(1-Azetidinylmethyl)phenyl](4-bromophenyl)methanone
- Methanone, [2-(1-azetidinylmethyl)phenyl](4-bromophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.