CAS 898754-78-4
:1-(2,5-Dimethylphenyl)-3-[2-(methylthio)phenyl]-1-propanone
Description:
1-(2,5-Dimethylphenyl)-3-[2-(methylthio)phenyl]-1-propanone, identified by its CAS number 898754-78-4, is an organic compound that belongs to the class of ketones. It features a propanone backbone substituted with two distinct aromatic groups: a 2,5-dimethylphenyl group and a 2-(methylthio)phenyl group. This compound is characterized by its relatively complex structure, which contributes to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the methylthio group can influence its reactivity and interaction with other chemical species, potentially making it useful in various applications, including organic synthesis and as a photoinitiator in polymer chemistry. Additionally, the presence of multiple methyl groups can enhance its hydrophobicity, affecting its behavior in different environments. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C18H20OS
InChI:InChI=1S/C18H20OS/c1-13-8-9-14(2)16(12-13)17(19)11-10-15-6-4-5-7-18(15)20-3/h4-9,12H,10-11H2,1-3H3
InChI key:InChIKey=JUIQOMTWTBVTGQ-UHFFFAOYSA-N
SMILES:C(CCC1=C(SC)C=CC=C1)(=O)C2=C(C)C=CC(C)=C2
Synonyms:- 1-(2,5-Dimethylphenyl)-3-[2-(methylsulfanyl)phenyl]-1-propanone
- 1-Propanone, 1-(2,5-dimethylphenyl)-3-[2-(methylthio)phenyl]-
- 1-(2,5-Dimethylphenyl)-3-[2-(methylthio)phenyl]-1-propanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.