CymitQuimica logo

CAS 898754-80-8

:

Methanone, [2-(1-azetidinylmethyl)phenyl](3-fluorophenyl)-

Description:
Methanone, [2-(1-azetidinylmethyl)phenyl](3-fluorophenyl)-, also known by its CAS number 898754-80-8, is a chemical compound characterized by its unique structure that includes a methanone functional group and a phenyl ring substituted with a fluorine atom. The presence of the azetidine moiety indicates that it contains a four-membered nitrogen-containing ring, which can influence its reactivity and biological activity. This compound is likely to exhibit properties typical of ketones, such as being polar and capable of participating in various chemical reactions, including nucleophilic additions. The fluorine substitution on the phenyl ring may enhance lipophilicity and alter the compound's pharmacokinetic properties, making it of interest in medicinal chemistry. Additionally, the presence of the azetidine group may contribute to its potential as a ligand in biological systems or as a precursor in synthetic pathways. Overall, this compound's structural features suggest it may have applications in pharmaceuticals or agrochemicals, although specific biological activities would require further investigation.
Formula:C17H16FNO
InChI:InChI=1S/C17H16FNO/c18-15-7-3-6-13(11-15)17(20)16-8-2-1-5-14(16)12-19-9-4-10-19/h1-3,5-8,11H,4,9-10,12H2
InChI key:InChIKey=FDVQMVKDIMUHGY-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(CN2CCC2)C=CC=C1)C3=CC(F)=CC=C3
Synonyms:
  • Methanone, [2-(1-azetidinylmethyl)phenyl](3-fluorophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.