CAS 898754-81-9
:1-(2,6-dimethylphenyl)-3-(2-methylsulfanylphenyl)propan-1-one
Description:
1-(2,6-Dimethylphenyl)-3-(2-methylsulfanylphenyl)propan-1-one, with the CAS number 898754-81-9, is an organic compound that belongs to the class of ketones. It features a propanone backbone substituted with two distinct aromatic groups: a 2,6-dimethylphenyl group and a 2-methylsulfanylphenyl group. The presence of the methylsulfanyl group introduces a sulfur atom, which can influence the compound's reactivity and solubility. This compound is likely to exhibit moderate to high lipophilicity due to its aromatic structures, making it soluble in organic solvents but less so in water. Its molecular structure suggests potential applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. Additionally, the presence of multiple methyl groups may enhance its stability and influence its physical properties, such as melting and boiling points. As with many organic compounds, safety precautions should be taken when handling this substance, as it may pose health risks if inhaled or ingested.
Formula:C18H20OS
InChI:InChI=1/C18H20OS/c1-13-7-6-8-14(2)18(13)16(19)12-11-15-9-4-5-10-17(15)20-3/h4-10H,11-12H2,1-3H3
SMILES:Cc1cccc(C)c1C(=O)CCc1ccccc1SC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.